About 9H-fluoren-1-ylmethyl carbamate
9H-fluoren-1-ylmethyl carbamate (PubChem CID 22645028) has the molecular formula C15H13NO2
and a molecular weight of 239.27 g/mol. Its IUPAC name is 9H-fluoren-1-ylmethyl carbamate.
Molecular Properties
| Compound Name | 9H-fluoren-1-ylmethyl carbamate |
| PubChem CID | 22645028 |
| Molecular Formula | C15H13NO2 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.09 |
| IUPAC Name | 9H-fluoren-1-ylmethyl carbamate |
| SMILES | NC(=O)OCc1cccc2c1Cc1ccccc1-2 |
| InChI | InChI=1S/C15H13NO2/c16-15(17)18-9-11-5-3-7-13-12-6-2-1-4-10(12)8-14(11)13/h1-7H,8-9H2,(H2,16,17) |
| InChIKey | GDXXYJRQFQZYNL-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 9H-fluoren-1-ylmethyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluoren-1-ylmethyl carbamate?
The IUPAC name of 9H-fluoren-1-ylmethyl carbamate (CID 22645028) is 9H-fluoren-1-ylmethyl carbamate.
What is the SMILES notation for 9H-fluoren-1-ylmethyl carbamate?
The canonical SMILES for 9H-fluoren-1-ylmethyl carbamate is NC(=O)OCc1cccc2c1Cc1ccccc1-2.
What is the InChIKey of 9H-fluoren-1-ylmethyl carbamate?
The InChIKey is GDXXYJRQFQZYNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H13NO2/c16-15(17)18-9-11-5-3-7-13-12-6-2-1-4-10(12)8-14(11)13/h1-7H,8-9H2,(H2,16,17).
What are the key properties of 9H-fluoren-1-ylmethyl carbamate?
9H-fluoren-1-ylmethyl carbamate has a molecular weight of 239.27 g/mol, XLogP of 2.85, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluoren-1-ylmethyl carbamate is sourced from PubChem (CID 22645028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).