C16H23N3O6 — CID 22645630
[3-[acetyloxy-[methyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]methyl]-2-pyridinyl]carbamic acid (PubChem CID 22645630) has the molecular formula C16H23N3O6 and a molecular weight of 353.38 g/mol. Its IUPAC name is [3-[acetyloxy-[methyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]methyl]-2-pyridinyl]carbamic acid.
| Compound Name | [3-[acetyloxy-[methyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]methyl]-2-pyridinyl]carbamic acid |
|---|---|
| PubChem CID | 22645630 |
| Molecular Formula | C16H23N3O6 |
| Molecular Weight | 353.38 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | [3-[acetyloxy-[methyl-[2-[(2-methylpropan-2-yl)oxy]-2-oxoethyl]amino]methyl]-2-pyridinyl]carbamic acid |
| SMILES | CC(=O)OC(c1cccnc1NC(=O)O)N(C)CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H23N3O6/c1-10(20)24-14(19(5)9-12(21)25-16(2,3)4)11-7-6-8-17-13(11)18-15(22)23/h6-8,14H,9H2,1-5H3,(H,17,18)(H,22,23) |
| InChIKey | ZUAWAMVRCRZXJN-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 118.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.38 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|