About 1-ethenoxy-1,2,2-trifluoroethane
1-ethenoxy-1,2,2-trifluoroethane (PubChem CID 22645809) has the molecular formula C4H5F3O
and a molecular weight of 126.08 g/mol. Its IUPAC name is 1-ethenoxy-1,2,2-trifluoroethane.
Molecular Properties
| Compound Name | 1-ethenoxy-1,2,2-trifluoroethane |
| PubChem CID | 22645809 |
| Molecular Formula | C4H5F3O |
| Molecular Weight | 126.08 g/mol |
| Exact Mass | 126.03 |
| IUPAC Name | 1-ethenoxy-1,2,2-trifluoroethane |
| SMILES | C=COC(F)C(F)F |
| InChI | InChI=1S/C4H5F3O/c1-2-8-4(7)3(5)6/h2-4H,1H2 |
| InChIKey | RGYAMCMWMFJUCN-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.08 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenoxy-1,2,2-trifluoroethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenoxy-1,2,2-trifluoroethane?
The IUPAC name of 1-ethenoxy-1,2,2-trifluoroethane (CID 22645809) is 1-ethenoxy-1,2,2-trifluoroethane.
What is the SMILES notation for 1-ethenoxy-1,2,2-trifluoroethane?
The canonical SMILES for 1-ethenoxy-1,2,2-trifluoroethane is C=COC(F)C(F)F.
What is the InChIKey of 1-ethenoxy-1,2,2-trifluoroethane?
The InChIKey is RGYAMCMWMFJUCN-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5F3O/c1-2-8-4(7)3(5)6/h2-4H,1H2.
What are the key properties of 1-ethenoxy-1,2,2-trifluoroethane?
1-ethenoxy-1,2,2-trifluoroethane has a molecular weight of 126.08 g/mol, XLogP of 1.71, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenoxy-1,2,2-trifluoroethane is sourced from PubChem (CID 22645809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).