C10H8F14O — CID 22646023
1,1,1,2,2,3,3-heptafluoro-4-(3,3,4,4,5,5,5-heptafluoropentan-2-yloxy)pentane (PubChem CID 22646023) has the molecular formula C10H8F14O and a molecular weight of 410.15 g/mol. Its IUPAC name is 1,1,1,2,2,3,3-heptafluoro-4-(3,3,4,4,5,5,5-heptafluoropentan-2-yloxy)pentane.
| Compound Name | 1,1,1,2,2,3,3-heptafluoro-4-(3,3,4,4,5,5,5-heptafluoropentan-2-yloxy)pentane |
|---|---|
| PubChem CID | 22646023 |
| Molecular Formula | C10H8F14O |
| Molecular Weight | 410.15 g/mol |
| Exact Mass | 410.04 |
| IUPAC Name | 1,1,1,2,2,3,3-heptafluoro-4-(3,3,4,4,5,5,5-heptafluoropentan-2-yloxy)pentane |
| SMILES | CC(OC(C)C(F)(F)C(F)(F)C(F)(F)F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C10H8F14O/c1-3(5(11,12)7(15,16)9(19,20)21)25-4(2)6(13,14)8(17,18)10(22,23)24/h3-4H,1-2H3 |
| InChIKey | SFPLIYFLVJBGIG-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.15 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|