5-methyl-1,3-oxazole-2-carboxylic acid

C5H5NO3 — CID 22646753

IUPAC5-methyl-1,3-oxazole-2-carboxylic acid
SMILESCc1cnc(C(=O)O)o1
InChIInChI=1S/C5H5NO3/c1-3-2-6-4(9-3)5(7)8/h2H,1H3,(H,7,8)
InChIKeyODPPPGVWSBDXFN-UHFFFAOYSA-N
MW127.10 g/mol
LogP0.68
Rot. Bonds1

About 5-methyl-1,3-oxazole-2-carboxylic acid

5-methyl-1,3-oxazole-2-carboxylic acid (PubChem CID 22646753) has the molecular formula C5H5NO3 and a molecular weight of 127.10 g/mol. Its IUPAC name is 5-methyl-1,3-oxazole-2-carboxylic acid.

Molecular Properties

Compound Name5-methyl-1,3-oxazole-2-carboxylic acid
PubChem CID22646753
Molecular FormulaC5H5NO3
Molecular Weight127.10 g/mol
Exact Mass127.03
IUPAC Name5-methyl-1,3-oxazole-2-carboxylic acid
SMILESCc1cnc(C(=O)O)o1
InChIInChI=1S/C5H5NO3/c1-3-2-6-4(9-3)5(7)8/h2H,1H3,(H,7,8)
InChIKeyODPPPGVWSBDXFN-UHFFFAOYSA-N
XLogP0.68
TPSA63.33 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms9
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500127.10
LogP ≤ 50.68
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 5-methyl-1,3-oxazole-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-methyl-1,3-oxazole-2-carboxylic acid?
The IUPAC name of 5-methyl-1,3-oxazole-2-carboxylic acid (CID 22646753) is 5-methyl-1,3-oxazole-2-carboxylic acid.
What is the SMILES notation for 5-methyl-1,3-oxazole-2-carboxylic acid?
The canonical SMILES for 5-methyl-1,3-oxazole-2-carboxylic acid is Cc1cnc(C(=O)O)o1.
What is the InChIKey of 5-methyl-1,3-oxazole-2-carboxylic acid?
The InChIKey is ODPPPGVWSBDXFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5NO3/c1-3-2-6-4(9-3)5(7)8/h2H,1H3,(H,7,8).
What are the key properties of 5-methyl-1,3-oxazole-2-carboxylic acid?
5-methyl-1,3-oxazole-2-carboxylic acid has a molecular weight of 127.10 g/mol, XLogP of 0.68, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-1,3-oxazole-2-carboxylic acid is sourced from PubChem (CID 22646753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).