C23H24FNO4S — CID 22647522
2-ethoxy-3-[3-fluoro-4-[3-(2-phenyl-1,3-thiazol-4-yl)propoxy]phenyl]propanoic acid (PubChem CID 22647522) has the molecular formula C23H24FNO4S and a molecular weight of 429.51 g/mol. Its IUPAC name is 2-ethoxy-3-[3-fluoro-4-[3-(2-phenyl-1,3-thiazol-4-yl)propoxy]phenyl]propanoic acid.
| Compound Name | 2-ethoxy-3-[3-fluoro-4-[3-(2-phenyl-1,3-thiazol-4-yl)propoxy]phenyl]propanoic acid |
|---|---|
| PubChem CID | 22647522 |
| Molecular Formula | C23H24FNO4S |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | 2-ethoxy-3-[3-fluoro-4-[3-(2-phenyl-1,3-thiazol-4-yl)propoxy]phenyl]propanoic acid |
| SMILES | CCOC(Cc1ccc(OCCCc2csc(-c3ccccc3)n2)c(F)c1)C(=O)O |
| InChI | InChI=1S/C23H24FNO4S/c1-2-28-21(23(26)27)14-16-10-11-20(19(24)13-16)29-12-6-9-18-15-30-22(25-18)17-7-4-3-5-8-17/h3-5,7-8,10-11,13,15,21H,2,6,9,12,14H2,1H3,(H,26,27) |
| InChIKey | HOMOKUDXJASATD-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 68.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|