About 2-amino-3,4,5-trihydroxyhexanal
2-amino-3,4,5-trihydroxyhexanal (PubChem CID 22647636) has the molecular formula C6H13NO4
and a molecular weight of 163.17 g/mol. Its IUPAC name is 2-amino-3,4,5-trihydroxyhexanal.
Molecular Properties
| Compound Name | 2-amino-3,4,5-trihydroxyhexanal |
| PubChem CID | 22647636 |
| Molecular Formula | C6H13NO4 |
| Molecular Weight | 163.17 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | 2-amino-3,4,5-trihydroxyhexanal |
| SMILES | CC(O)C(O)C(O)C(N)C=O |
| InChI | InChI=1S/C6H13NO4/c1-3(9)5(10)6(11)4(7)2-8/h2-6,9-11H,7H2,1H3 |
| InChIKey | NTBYIQWZAVDRHA-UHFFFAOYSA-N |
| XLogP | -2.38 |
| TPSA | 103.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 163.17 |
| LogP ≤ 5 | -2.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-amino-3,4,5-trihydroxyhexanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-3,4,5-trihydroxyhexanal?
The IUPAC name of 2-amino-3,4,5-trihydroxyhexanal (CID 22647636) is 2-amino-3,4,5-trihydroxyhexanal.
What is the SMILES notation for 2-amino-3,4,5-trihydroxyhexanal?
The canonical SMILES for 2-amino-3,4,5-trihydroxyhexanal is CC(O)C(O)C(O)C(N)C=O.
What is the InChIKey of 2-amino-3,4,5-trihydroxyhexanal?
The InChIKey is NTBYIQWZAVDRHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO4/c1-3(9)5(10)6(11)4(7)2-8/h2-6,9-11H,7H2,1H3.
What are the key properties of 2-amino-3,4,5-trihydroxyhexanal?
2-amino-3,4,5-trihydroxyhexanal has a molecular weight of 163.17 g/mol, XLogP of -2.38, 4 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-3,4,5-trihydroxyhexanal is sourced from PubChem (CID 22647636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).