C10H13F3O3 — CID 22648767
(3E)-3-(ethoxymethylidene)-1,1,1-trifluoro-5-methylhexane-2,4-dione (PubChem CID 22648767) has the molecular formula C10H13F3O3 and a molecular weight of 238.20 g/mol. Its IUPAC name is (3E)-3-(ethoxymethylidene)-1,1,1-trifluoro-5-methylhexane-2,4-dione.
| Compound Name | (3E)-3-(ethoxymethylidene)-1,1,1-trifluoro-5-methylhexane-2,4-dione |
|---|---|
| PubChem CID | 22648767 |
| Molecular Formula | C10H13F3O3 |
| Molecular Weight | 238.20 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | (3E)-3-(ethoxymethylidene)-1,1,1-trifluoro-5-methylhexane-2,4-dione |
| SMILES | CCO/C=C(\C(=O)C(C)C)C(=O)C(F)(F)F |
| InChI | InChI=1S/C10H13F3O3/c1-4-16-5-7(8(14)6(2)3)9(15)10(11,12)13/h5-6H,4H2,1-3H3/b7-5+ |
| InChIKey | YJSGEOADFUVODU-FNORWQNLSA-N |
| XLogP | 2.26 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.20 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|