C14H23N5S2 — CID 22648952
2-N-(2-methylpropyl)-5-pentylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidine-2,7-diamine (PubChem CID 22648952) has the molecular formula C14H23N5S2 and a molecular weight of 325.51 g/mol. Its IUPAC name is 2-N-(2-methylpropyl)-5-pentylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidine-2,7-diamine.
| Compound Name | 2-N-(2-methylpropyl)-5-pentylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidine-2,7-diamine |
|---|---|
| PubChem CID | 22648952 |
| Molecular Formula | C14H23N5S2 |
| Molecular Weight | 325.51 g/mol |
| Exact Mass | 325.14 |
| IUPAC Name | 2-N-(2-methylpropyl)-5-pentylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidine-2,7-diamine |
| SMILES | CCCCCSc1nc(N)c2sc(NCC(C)C)nc2n1 |
| InChI | InChI=1S/C14H23N5S2/c1-4-5-6-7-20-14-17-11(15)10-12(19-14)18-13(21-10)16-8-9(2)3/h9H,4-8H2,1-3H3,(H3,15,16,17,18,19) |
| InChIKey | VLDWADVDVQIVBC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 76.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.51 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|