C12H19N5OS2 — CID 22648978
2-[(2-amino-5-pentylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)amino]ethanol (PubChem CID 22648978) has the molecular formula C12H19N5OS2 and a molecular weight of 313.45 g/mol. Its IUPAC name is 2-[(2-amino-5-pentylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)amino]ethanol.
| Compound Name | 2-[(2-amino-5-pentylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)amino]ethanol |
|---|---|
| PubChem CID | 22648978 |
| Molecular Formula | C12H19N5OS2 |
| Molecular Weight | 313.45 g/mol |
| Exact Mass | 313.10 |
| IUPAC Name | 2-[(2-amino-5-pentylsulfanyl-[1,3]thiazolo[4,5-d]pyrimidin-7-yl)amino]ethanol |
| SMILES | CCCCCSc1nc(NCCO)c2sc(N)nc2n1 |
| InChI | InChI=1S/C12H19N5OS2/c1-2-3-4-7-19-12-16-9(14-5-6-18)8-10(17-12)15-11(13)20-8/h18H,2-7H2,1H3,(H3,13,14,15,16,17) |
| InChIKey | IQWZNPGSAYIIQQ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 96.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.45 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|