About quinazolin-4-ylthiourea
quinazolin-4-ylthiourea (PubChem CID 22649288) has the molecular formula C9H8N4S
and a molecular weight of 204.26 g/mol. Its IUPAC name is quinazolin-4-ylthiourea.
Molecular Properties
| Compound Name | quinazolin-4-ylthiourea |
| PubChem CID | 22649288 |
| Molecular Formula | C9H8N4S |
| Molecular Weight | 204.26 g/mol |
| Exact Mass | 204.05 |
| IUPAC Name | quinazolin-4-ylthiourea |
| SMILES | NC(=S)Nc1ncnc2ccccc12 |
| InChI | InChI=1S/C9H8N4S/c10-9(14)13-8-6-3-1-2-4-7(6)11-5-12-8/h1-5H,(H3,10,11,12,13,14) |
| InChIKey | HKYMXPNZRPNCNW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.26 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze quinazolin-4-ylthiourea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of quinazolin-4-ylthiourea?
The IUPAC name of quinazolin-4-ylthiourea (CID 22649288) is quinazolin-4-ylthiourea.
What is the SMILES notation for quinazolin-4-ylthiourea?
The canonical SMILES for quinazolin-4-ylthiourea is NC(=S)Nc1ncnc2ccccc12.
What is the InChIKey of quinazolin-4-ylthiourea?
The InChIKey is HKYMXPNZRPNCNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N4S/c10-9(14)13-8-6-3-1-2-4-7(6)11-5-12-8/h1-5H,(H3,10,11,12,13,14).
What are the key properties of quinazolin-4-ylthiourea?
quinazolin-4-ylthiourea has a molecular weight of 204.26 g/mol, XLogP of 1.29, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for quinazolin-4-ylthiourea is sourced from PubChem (CID 22649288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).