C12H11NO5 — CID 22649364
6,7-dimethoxy-2-oxo-1H-quinoline-3-carboxylic acid (PubChem CID 22649364) has the molecular formula C12H11NO5 and a molecular weight of 249.22 g/mol. Its IUPAC name is 6,7-dimethoxy-2-oxo-1H-quinoline-3-carboxylic acid.
| Compound Name | 6,7-dimethoxy-2-oxo-1H-quinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 22649364 |
| Molecular Formula | C12H11NO5 |
| Molecular Weight | 249.22 g/mol |
| Exact Mass | 249.06 |
| IUPAC Name | 6,7-dimethoxy-2-oxo-1H-quinoline-3-carboxylic acid |
| SMILES | COc1cc2cc(C(=O)O)c(=O)[nH]c2cc1OC |
| InChI | InChI=1S/C12H11NO5/c1-17-9-4-6-3-7(12(15)16)11(14)13-8(6)5-10(9)18-2/h3-5H,1-2H3,(H,13,14)(H,15,16) |
| InChIKey | GOUXIRZIIJBHEA-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 88.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.22 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |