C18H35N7O7 — CID 22650400
2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-hydroxypropanoyl]amino]-4-methylpentanoic acid (PubChem CID 22650400) has the molecular formula C18H35N7O7 and a molecular weight of 461.52 g/mol. Its IUPAC name is 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-hydroxypropanoyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-hydroxypropanoyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 22650400 |
| Molecular Formula | C18H35N7O7 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.26 |
| IUPAC Name | 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-hydroxypropanoyl]amino]-3-hydroxypropanoyl]amino]-4-methylpentanoic acid |
| SMILES | CC(C)CC(NC(=O)C(CO)NC(=O)C(CO)NC(=O)C(N)CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C18H35N7O7/c1-9(2)6-11(17(31)32)23-15(29)13(8-27)25-16(30)12(7-26)24-14(28)10(19)4-3-5-22-18(20)21/h9-13,26-27H,3-8,19H2,1-2H3,(H,23,29)(H,24,28)(H,25,30)(H,31,32)(H4,20,21,22) |
| InChIKey | SFSCTRNTDKSDOP-UHFFFAOYSA-N |
| XLogP | -4.06 |
| TPSA | 255.48 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | -4.06 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|