About 6,7-dimethoxy-1-methyl-3,4-dihydroisoquinoline
6,7-dimethoxy-1-methyl-3,4-dihydroisoquinoline (PubChem CID 22652) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is 6,7-dimethoxy-1-methyl-3,4-dihydroisoquinoline.
Molecular Properties
| Compound Name | 6,7-dimethoxy-1-methyl-3,4-dihydroisoquinoline |
| PubChem CID | 22652 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 6,7-dimethoxy-1-methyl-3,4-dihydroisoquinoline |
| SMILES | COc1cc2c(cc1OC)C(C)=NCC2 |
| InChI | InChI=1S/C12H15NO2/c1-8-10-7-12(15-3)11(14-2)6-9(10)4-5-13-8/h6-7H,4-5H2,1-3H3 |
| InChIKey | VASUQTGZAPZKFK-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 30.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6,7-dimethoxy-1-methyl-3,4-dihydroisoquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,7-dimethoxy-1-methyl-3,4-dihydroisoquinoline?
The IUPAC name of 6,7-dimethoxy-1-methyl-3,4-dihydroisoquinoline (CID 22652) is 6,7-dimethoxy-1-methyl-3,4-dihydroisoquinoline.
What is the SMILES notation for 6,7-dimethoxy-1-methyl-3,4-dihydroisoquinoline?
The canonical SMILES for 6,7-dimethoxy-1-methyl-3,4-dihydroisoquinoline is COc1cc2c(cc1OC)C(C)=NCC2.
What is the InChIKey of 6,7-dimethoxy-1-methyl-3,4-dihydroisoquinoline?
The InChIKey is VASUQTGZAPZKFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2/c1-8-10-7-12(15-3)11(14-2)6-9(10)4-5-13-8/h6-7H,4-5H2,1-3H3.
What are the key properties of 6,7-dimethoxy-1-methyl-3,4-dihydroisoquinoline?
6,7-dimethoxy-1-methyl-3,4-dihydroisoquinoline has a molecular weight of 205.26 g/mol, XLogP of 2.07, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,7-dimethoxy-1-methyl-3,4-dihydroisoquinoline is sourced from PubChem (CID 22652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).