About CID 2265261
CID 2265261 (PubChem CID 2265261) has the molecular formula C28H33NO6
and a molecular weight of 479.57 g/mol.
Molecular Properties
| Compound Name | CID 2265261 |
| PubChem CID | 2265261 |
| Molecular Formula | C28H33NO6 |
| Molecular Weight | 479.57 g/mol |
| Exact Mass | 479.23 |
| IUPAC Name | — |
| SMILES | O=C(Nc1cccc2ccccc12)[C@@H]1O[C@H]2OC3(CCCCC3)O[C@@H]2[C@H]2OC3(CCCCC3)O[C@H]21 |
| InChI | InChI=1S/C28H33NO6/c30-25(29-20-13-9-11-18-10-3-4-12-19(18)20)23-21-22(33-27(32-21)14-5-1-6-15-27)24-26(31-23)35-28(34-24)16-7-2-8-17-28/h3-4,9-13,21-24,26H,1-2,5-8,14-17H2,(H,29,30)/t21-,22+,23-,24-,26+/m1/s1 |
| InChIKey | IYOLBWZBSSAWQE-UMCRWDIXSA-N |
| XLogP | 5.02 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 479.57 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze CID 2265261 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 2265261?
The IUPAC name of CID 2265261 (CID 2265261) is not available.
What is the SMILES notation for CID 2265261?
The canonical SMILES for CID 2265261 is O=C(Nc1cccc2ccccc12)[C@@H]1O[C@H]2OC3(CCCCC3)O[C@@H]2[C@H]2OC3(CCCCC3)O[C@H]21.
What is the InChIKey of CID 2265261?
The InChIKey is IYOLBWZBSSAWQE-UMCRWDIXSA-N. The full InChI is InChI=1S/C28H33NO6/c30-25(29-20-13-9-11-18-10-3-4-12-19(18)20)23-21-22(33-27(32-21)14-5-1-6-15-27)24-26(31-23)35-28(34-24)16-7-2-8-17-28/h3-4,9-13,21-24,26H,1-2,5-8,14-17H2,(H,29,30)/t21-,22+,23-,24-,26+/m1/s1.
What are the key properties of CID 2265261?
CID 2265261 has a molecular weight of 479.57 g/mol, XLogP of 5.02, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 2265261 is sourced from PubChem (CID 2265261), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).