C12H20N2O3 — CID 2265578
methyl (2Z,4E)-2-acetyl-3,5-bis(dimethylamino)penta-2,4-dienoate (PubChem CID 2265578) has the molecular formula C12H20N2O3 and a molecular weight of 240.30 g/mol. Its IUPAC name is methyl (2Z,4E)-2-acetyl-3,5-bis(dimethylamino)penta-2,4-dienoate.
| Compound Name | methyl (2Z,4E)-2-acetyl-3,5-bis(dimethylamino)penta-2,4-dienoate |
|---|---|
| PubChem CID | 2265578 |
| Molecular Formula | C12H20N2O3 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | methyl (2Z,4E)-2-acetyl-3,5-bis(dimethylamino)penta-2,4-dienoate |
| SMILES | COC(=O)/C(C(C)=O)=C(/C=C/N(C)C)N(C)C |
| InChI | InChI=1S/C12H20N2O3/c1-9(15)11(12(16)17-6)10(14(4)5)7-8-13(2)3/h7-8H,1-6H3/b8-7+,11-10- |
| InChIKey | SFNDNKOGIYSSQY-LFOHPMNASA-N |
| XLogP | 0.64 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|