About (2E,4Z)-1-(2-adamantyl)-5-(dimethylamino)penta-2,4-dien-1-one
(2E,4Z)-1-(2-adamantyl)-5-(dimethylamino)penta-2,4-dien-1-one (PubChem CID 2265588) has the molecular formula C17H25NO
and a molecular weight of 259.39 g/mol. Its IUPAC name is (2E,4Z)-1-(2-adamantyl)-5-(dimethylamino)penta-2,4-dien-1-one.
Molecular Properties
| Compound Name | (2E,4Z)-1-(2-adamantyl)-5-(dimethylamino)penta-2,4-dien-1-one |
| PubChem CID | 2265588 |
| Molecular Formula | C17H25NO |
| Molecular Weight | 259.39 g/mol |
| Exact Mass | 259.19 |
| IUPAC Name | (2E,4Z)-1-(2-adamantyl)-5-(dimethylamino)penta-2,4-dien-1-one |
| SMILES | CN(C)/C=C\C=C\C(=O)C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C17H25NO/c1-18(2)6-4-3-5-16(19)17-14-8-12-7-13(10-14)11-15(17)9-12/h3-6,12-15,17H,7-11H2,1-2H3/b5-3+,6-4- |
| InChIKey | MZSBLFBMITZSOA-UZNMPDEFSA-N |
| XLogP | 3.26 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (2E,4Z)-1-(2-adamantyl)-5-(dimethylamino)penta-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2E,4Z)-1-(2-adamantyl)-5-(dimethylamino)penta-2,4-dien-1-one?
The IUPAC name of (2E,4Z)-1-(2-adamantyl)-5-(dimethylamino)penta-2,4-dien-1-one (CID 2265588) is (2E,4Z)-1-(2-adamantyl)-5-(dimethylamino)penta-2,4-dien-1-one.
What is the SMILES notation for (2E,4Z)-1-(2-adamantyl)-5-(dimethylamino)penta-2,4-dien-1-one?
The canonical SMILES for (2E,4Z)-1-(2-adamantyl)-5-(dimethylamino)penta-2,4-dien-1-one is CN(C)/C=C\C=C\C(=O)C1C2CC3CC(C2)CC1C3.
What is the InChIKey of (2E,4Z)-1-(2-adamantyl)-5-(dimethylamino)penta-2,4-dien-1-one?
The InChIKey is MZSBLFBMITZSOA-UZNMPDEFSA-N. The full InChI is InChI=1S/C17H25NO/c1-18(2)6-4-3-5-16(19)17-14-8-12-7-13(10-14)11-15(17)9-12/h3-6,12-15,17H,7-11H2,1-2H3/b5-3+,6-4-.
What are the key properties of (2E,4Z)-1-(2-adamantyl)-5-(dimethylamino)penta-2,4-dien-1-one?
(2E,4Z)-1-(2-adamantyl)-5-(dimethylamino)penta-2,4-dien-1-one has a molecular weight of 259.39 g/mol, XLogP of 3.26, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,4Z)-1-(2-adamantyl)-5-(dimethylamino)penta-2,4-dien-1-one is sourced from PubChem (CID 2265588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).