C20H15Cl3N2O3 — CID 2265655
N-[(2-methoxynaphthalen-1-yl)methylideneamino]-2-(2,4,6-trichlorophenoxy)acetamide (PubChem CID 2265655) has the molecular formula C20H15Cl3N2O3 and a molecular weight of 437.71 g/mol. Its IUPAC name is N-[(2-methoxynaphthalen-1-yl)methylideneamino]-2-(2,4,6-trichlorophenoxy)acetamide.
| Compound Name | N-[(2-methoxynaphthalen-1-yl)methylideneamino]-2-(2,4,6-trichlorophenoxy)acetamide |
|---|---|
| PubChem CID | 2265655 |
| Molecular Formula | C20H15Cl3N2O3 |
| Molecular Weight | 437.71 g/mol |
| Exact Mass | 436.01 |
| IUPAC Name | N-[(2-methoxynaphthalen-1-yl)methylideneamino]-2-(2,4,6-trichlorophenoxy)acetamide |
| SMILES | COc1ccc2ccccc2c1C=NNC(=O)COc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C20H15Cl3N2O3/c1-27-18-7-6-12-4-2-3-5-14(12)15(18)10-24-25-19(26)11-28-20-16(22)8-13(21)9-17(20)23/h2-10H,11H2,1H3,(H,25,26) |
| InChIKey | KCGOUOKIDYSGOO-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.71 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|