About 2-(dibenzylamino)ethanol
2-(dibenzylamino)ethanol (PubChem CID 22657) has the molecular formula C16H19NO
and a molecular weight of 241.33 g/mol. Its IUPAC name is 2-(dibenzylamino)ethanol.
Molecular Properties
| Compound Name | 2-(dibenzylamino)ethanol |
| PubChem CID | 22657 |
| Molecular Formula | C16H19NO |
| Molecular Weight | 241.33 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | 2-(dibenzylamino)ethanol |
| SMILES | OCCN(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C16H19NO/c18-12-11-17(13-15-7-3-1-4-8-15)14-16-9-5-2-6-10-16/h1-10,18H,11-14H2 |
| InChIKey | WTTWSMJHJFNCQB-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.33 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(dibenzylamino)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dibenzylamino)ethanol?
The IUPAC name of 2-(dibenzylamino)ethanol (CID 22657) is 2-(dibenzylamino)ethanol.
What is the SMILES notation for 2-(dibenzylamino)ethanol?
The canonical SMILES for 2-(dibenzylamino)ethanol is OCCN(Cc1ccccc1)Cc1ccccc1.
What is the InChIKey of 2-(dibenzylamino)ethanol?
The InChIKey is WTTWSMJHJFNCQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO/c18-12-11-17(13-15-7-3-1-4-8-15)14-16-9-5-2-6-10-16/h1-10,18H,11-14H2.
What are the key properties of 2-(dibenzylamino)ethanol?
2-(dibenzylamino)ethanol has a molecular weight of 241.33 g/mol, XLogP of 2.68, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dibenzylamino)ethanol is sourced from PubChem (CID 22657), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).