C20H27N5O8S — CID 22657348
2-[[2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoyl]amino]butanedioic acid (PubChem CID 22657348) has the molecular formula C20H27N5O8S and a molecular weight of 497.53 g/mol. Its IUPAC name is 2-[[2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoyl]amino]butanedioic acid.
| Compound Name | 2-[[2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 22657348 |
| Molecular Formula | C20H27N5O8S |
| Molecular Weight | 497.53 g/mol |
| Exact Mass | 497.16 |
| IUPAC Name | 2-[[2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-phenylpropanoyl]amino]-3-sulfanylpropanoyl]amino]butanedioic acid |
| SMILES | NC(=O)CC(N)C(=O)NC(Cc1ccccc1)C(=O)NC(CS)C(=O)NC(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C20H27N5O8S/c21-11(7-15(22)26)17(29)23-12(6-10-4-2-1-3-5-10)18(30)25-14(9-34)19(31)24-13(20(32)33)8-16(27)28/h1-5,11-14,34H,6-9,21H2,(H2,22,26)(H,23,29)(H,24,31)(H,25,30)(H,27,28)(H,32,33) |
| InChIKey | WFYQLIDKDWFDGR-UHFFFAOYSA-N |
| XLogP | -2.62 |
| TPSA | 231.01 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.53 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|