C10H11N5O3S2 — CID 2265973
N-(4-sulfamoylphenyl)-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide (PubChem CID 2265973) has the molecular formula C10H11N5O3S2 and a molecular weight of 313.36 g/mol. Its IUPAC name is N-(4-sulfamoylphenyl)-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide.
| Compound Name | N-(4-sulfamoylphenyl)-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide |
|---|---|
| PubChem CID | 2265973 |
| Molecular Formula | C10H11N5O3S2 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | N-(4-sulfamoylphenyl)-2-(1H-1,2,4-triazol-5-ylsulfanyl)acetamide |
| SMILES | NS(=O)(=O)c1ccc(NC(=O)CSc2ncn[nH]2)cc1 |
| InChI | InChI=1S/C10H11N5O3S2/c11-20(17,18)8-3-1-7(2-4-8)14-9(16)5-19-10-12-6-13-15-10/h1-4,6H,5H2,(H,14,16)(H2,11,17,18)(H,12,13,15) |
| InChIKey | STPZUUYFRHSOLM-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |