C22H21F2NO4 — CID 22660983
(2Z)-N-[1,2-bis(4-fluorophenyl)ethyl]-2-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-ylidene)-N-methylacetamide (PubChem CID 22660983) has the molecular formula C22H21F2NO4 and a molecular weight of 401.41 g/mol. Its IUPAC name is (2Z)-N-[1,2-bis(4-fluorophenyl)ethyl]-2-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-ylidene)-N-methylacetamide.
| Compound Name | (2Z)-N-[1,2-bis(4-fluorophenyl)ethyl]-2-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-ylidene)-N-methylacetamide |
|---|---|
| PubChem CID | 22660983 |
| Molecular Formula | C22H21F2NO4 |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | (2Z)-N-[1,2-bis(4-fluorophenyl)ethyl]-2-(2,2-dimethyl-5-oxo-1,3-dioxolan-4-ylidene)-N-methylacetamide |
| SMILES | CN(C(=O)/C=C1\OC(C)(C)OC1=O)C(Cc1ccc(F)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H21F2NO4/c1-22(2)28-19(21(27)29-22)13-20(26)25(3)18(15-6-10-17(24)11-7-15)12-14-4-8-16(23)9-5-14/h4-11,13,18H,12H2,1-3H3/b19-13- |
| InChIKey | ARTBOBLSYGQZEN-UYRXBGFRSA-N |
| XLogP | 3.90 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|