1,4-dioxa-8-thiaspiro[4.5]decane-6-carboxylic acid

C8H12O4S — CID 22661465

IUPAC1,4-dioxa-8-thiaspiro[4.5]decane-6-carboxylic acid
SMILESO=C(O)C1CSCCC12OCCO2
InChIInChI=1S/C8H12O4S/c9-7(10)6-5-13-4-1-8(6)11-2-3-12-8/h6H,1-5H2,(H,9,10)
InChIKeyOCBDUACINCGEHB-UHFFFAOYSA-N
MW204.25 g/mol
LogP0.57
Rot. Bonds1

About 1,4-dioxa-8-thiaspiro[4.5]decane-6-carboxylic acid

1,4-dioxa-8-thiaspiro[4.5]decane-6-carboxylic acid (PubChem CID 22661465) has the molecular formula C8H12O4S and a molecular weight of 204.25 g/mol. Its IUPAC name is 1,4-dioxa-8-thiaspiro[4.5]decane-6-carboxylic acid.

Molecular Properties

Compound Name1,4-dioxa-8-thiaspiro[4.5]decane-6-carboxylic acid
PubChem CID22661465
Molecular FormulaC8H12O4S
Molecular Weight204.25 g/mol
Exact Mass204.05
IUPAC Name1,4-dioxa-8-thiaspiro[4.5]decane-6-carboxylic acid
SMILESO=C(O)C1CSCCC12OCCO2
InChIInChI=1S/C8H12O4S/c9-7(10)6-5-13-4-1-8(6)11-2-3-12-8/h6H,1-5H2,(H,9,10)
InChIKeyOCBDUACINCGEHB-UHFFFAOYSA-N
XLogP0.57
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500204.25
LogP ≤ 50.57
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 1,4-dioxa-8-thiaspiro[4.5]decane-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1,4-dioxa-8-thiaspiro[4.5]decane-6-carboxylic acid?
The IUPAC name of 1,4-dioxa-8-thiaspiro[4.5]decane-6-carboxylic acid (CID 22661465) is 1,4-dioxa-8-thiaspiro[4.5]decane-6-carboxylic acid.
What is the SMILES notation for 1,4-dioxa-8-thiaspiro[4.5]decane-6-carboxylic acid?
The canonical SMILES for 1,4-dioxa-8-thiaspiro[4.5]decane-6-carboxylic acid is O=C(O)C1CSCCC12OCCO2.
What is the InChIKey of 1,4-dioxa-8-thiaspiro[4.5]decane-6-carboxylic acid?
The InChIKey is OCBDUACINCGEHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O4S/c9-7(10)6-5-13-4-1-8(6)11-2-3-12-8/h6H,1-5H2,(H,9,10).
What are the key properties of 1,4-dioxa-8-thiaspiro[4.5]decane-6-carboxylic acid?
1,4-dioxa-8-thiaspiro[4.5]decane-6-carboxylic acid has a molecular weight of 204.25 g/mol, XLogP of 0.57, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,4-dioxa-8-thiaspiro[4.5]decane-6-carboxylic acid is sourced from PubChem (CID 22661465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).