About (3-methyl-1,2-oxazol-5-yl)methoxy-phenylmethanamine
(3-methyl-1,2-oxazol-5-yl)methoxy-phenylmethanamine (PubChem CID 22661876) has the molecular formula C12H14N2O2
and a molecular weight of 218.26 g/mol. Its IUPAC name is (3-methyl-1,2-oxazol-5-yl)methoxy-phenylmethanamine.
Molecular Properties
| Compound Name | (3-methyl-1,2-oxazol-5-yl)methoxy-phenylmethanamine |
| PubChem CID | 22661876 |
| Molecular Formula | C12H14N2O2 |
| Molecular Weight | 218.26 g/mol |
| Exact Mass | 218.11 |
| IUPAC Name | (3-methyl-1,2-oxazol-5-yl)methoxy-phenylmethanamine |
| SMILES | Cc1cc(COC(N)c2ccccc2)on1 |
| InChI | InChI=1S/C12H14N2O2/c1-9-7-11(16-14-9)8-15-12(13)10-5-3-2-4-6-10/h2-7,12H,8,13H2,1H3 |
| InChIKey | PFDCYXOAMRFZNL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 61.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.26 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (3-methyl-1,2-oxazol-5-yl)methoxy-phenylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-methyl-1,2-oxazol-5-yl)methoxy-phenylmethanamine?
The IUPAC name of (3-methyl-1,2-oxazol-5-yl)methoxy-phenylmethanamine (CID 22661876) is (3-methyl-1,2-oxazol-5-yl)methoxy-phenylmethanamine.
What is the SMILES notation for (3-methyl-1,2-oxazol-5-yl)methoxy-phenylmethanamine?
The canonical SMILES for (3-methyl-1,2-oxazol-5-yl)methoxy-phenylmethanamine is Cc1cc(COC(N)c2ccccc2)on1.
What is the InChIKey of (3-methyl-1,2-oxazol-5-yl)methoxy-phenylmethanamine?
The InChIKey is PFDCYXOAMRFZNL-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2O2/c1-9-7-11(16-14-9)8-15-12(13)10-5-3-2-4-6-10/h2-7,12H,8,13H2,1H3.
What are the key properties of (3-methyl-1,2-oxazol-5-yl)methoxy-phenylmethanamine?
(3-methyl-1,2-oxazol-5-yl)methoxy-phenylmethanamine has a molecular weight of 218.26 g/mol, XLogP of 2.16, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-methyl-1,2-oxazol-5-yl)methoxy-phenylmethanamine is sourced from PubChem (CID 22661876), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).