About hexamethyltrisilazane
hexamethyltrisilazane (PubChem CID 22662092) has the molecular formula C6H19N2Si3
and a molecular weight of 203.49 g/mol.
Molecular Properties
| Compound Name | hexamethyltrisilazane |
|---|
| PubChem CID | 22662092 |
|---|
| Molecular Formula | C6H19N2Si3 |
|---|
| Molecular Weight | 203.49 g/mol |
|---|
| Exact Mass | 203.09 |
|---|
| IUPAC Name | — |
|---|
| SMILES | CN([Si](C)(C)C)[Si](C)(C)N[Si] |
|---|
| InChI | InChI=1S/C6H19N2Si3/c1-8(10(2,3)4)11(5,6)7-9/h7H,1-6H3 |
|---|
| InChIKey | ZQLDGFAPKRTIHD-UHFFFAOYSA-N |
|---|
| XLogP | 1.13 |
|---|
| TPSA | 15.27 Ų |
|---|
| H-Bond Donors | 1 |
|---|
| H-Bond Acceptors | 2 |
|---|
| Rotatable Bonds | 3 |
|---|
| Heavy Atoms | 11 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 203.49 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze hexamethyltrisilazane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexamethyltrisilazane?
The IUPAC name of hexamethyltrisilazane (CID 22662092) is not available.
What is the SMILES notation for hexamethyltrisilazane?
The canonical SMILES for hexamethyltrisilazane is CN([Si](C)(C)C)[Si](C)(C)N[Si].
What is the InChIKey of hexamethyltrisilazane?
The InChIKey is ZQLDGFAPKRTIHD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H19N2Si3/c1-8(10(2,3)4)11(5,6)7-9/h7H,1-6H3.
What are the key properties of hexamethyltrisilazane?
hexamethyltrisilazane has a molecular weight of 203.49 g/mol, XLogP of 1.13, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexamethyltrisilazane is sourced from PubChem (CID 22662092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).