About 1,3-dihydroxypropyl prop-2-enoate
1,3-dihydroxypropyl prop-2-enoate (PubChem CID 22662497) has the molecular formula C6H10O4
and a molecular weight of 146.14 g/mol. Its IUPAC name is 1,3-dihydroxypropyl prop-2-enoate.
Molecular Properties
| Compound Name | 1,3-dihydroxypropyl prop-2-enoate |
| PubChem CID | 22662497 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | 1,3-dihydroxypropyl prop-2-enoate |
| SMILES | C=CC(=O)OC(O)CCO |
| InChI | InChI=1S/C6H10O4/c1-2-5(8)10-6(9)3-4-7/h2,6-7,9H,1,3-4H2 |
| InChIKey | LRWMSVQODDCQGL-UHFFFAOYSA-N |
| XLogP | -0.58 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dihydroxypropyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dihydroxypropyl prop-2-enoate?
The IUPAC name of 1,3-dihydroxypropyl prop-2-enoate (CID 22662497) is 1,3-dihydroxypropyl prop-2-enoate.
What is the SMILES notation for 1,3-dihydroxypropyl prop-2-enoate?
The canonical SMILES for 1,3-dihydroxypropyl prop-2-enoate is C=CC(=O)OC(O)CCO.
What is the InChIKey of 1,3-dihydroxypropyl prop-2-enoate?
The InChIKey is LRWMSVQODDCQGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10O4/c1-2-5(8)10-6(9)3-4-7/h2,6-7,9H,1,3-4H2.
What are the key properties of 1,3-dihydroxypropyl prop-2-enoate?
1,3-dihydroxypropyl prop-2-enoate has a molecular weight of 146.14 g/mol, XLogP of -0.58, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dihydroxypropyl prop-2-enoate is sourced from PubChem (CID 22662497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).