C9H13F5O3 — CID 22662585
1,1,1,3,3-pentafluoronon-8-ene-2,2,4-triol (PubChem CID 22662585) has the molecular formula C9H13F5O3 and a molecular weight of 264.19 g/mol. Its IUPAC name is 1,1,1,3,3-pentafluoronon-8-ene-2,2,4-triol.
| Compound Name | 1,1,1,3,3-pentafluoronon-8-ene-2,2,4-triol |
|---|---|
| PubChem CID | 22662585 |
| Molecular Formula | C9H13F5O3 |
| Molecular Weight | 264.19 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 1,1,1,3,3-pentafluoronon-8-ene-2,2,4-triol |
| SMILES | C=CCCCC(O)C(F)(F)C(O)(O)C(F)(F)F |
| InChI | InChI=1S/C9H13F5O3/c1-2-3-4-5-6(15)7(10,11)8(16,17)9(12,13)14/h2,6,15-17H,1,3-5H2 |
| InChIKey | FHRZPAMUVMRNDQ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.19 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|