C10H8ClNO2S2 — CID 22662722
11-chloro-6-methyl-2,5λ6-dithia-6-azatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene 5,5-dioxide (PubChem CID 22662722) has the molecular formula C10H8ClNO2S2 and a molecular weight of 273.77 g/mol. Its IUPAC name is 11-chloro-6-methyl-2,5λ6-dithia-6-azatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene 5,5-dioxide.
| Compound Name | 11-chloro-6-methyl-2,5λ6-dithia-6-azatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene 5,5-dioxide |
|---|---|
| PubChem CID | 22662722 |
| Molecular Formula | C10H8ClNO2S2 |
| Molecular Weight | 273.77 g/mol |
| Exact Mass | 272.97 |
| IUPAC Name | 11-chloro-6-methyl-2,5λ6-dithia-6-azatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene 5,5-dioxide |
| SMILES | CN1Cc2ccc(Cl)c3scc(c23)S1(=O)=O |
| InChI | InChI=1S/C10H8ClNO2S2/c1-12-4-6-2-3-7(11)10-9(6)8(5-15-10)16(12,13)14/h2-3,5H,4H2,1H3 |
| InChIKey | PTIJASVOIQIGJV-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.77 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |