About methyl 4-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-oxopyrazine-2-carboxylate
methyl 4-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-oxopyrazine-2-carboxylate (PubChem CID 22662777) has the molecular formula C11H14N2O7
and a molecular weight of 286.24 g/mol. Its IUPAC name is methyl 4-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-oxopyrazine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 4-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-oxopyrazine-2-carboxylate |
| PubChem CID | 22662777 |
| Molecular Formula | C11H14N2O7 |
| Molecular Weight | 286.24 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | methyl 4-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-oxopyrazine-2-carboxylate |
| SMILES | COC(=O)c1nccn(C2OC(CO)C(O)C2O)c1=O |
| InChI | InChI=1S/C11H14N2O7/c1-19-11(18)6-9(17)13(3-2-12-6)10-8(16)7(15)5(4-14)20-10/h2-3,5,7-8,10,14-16H,4H2,1H3 |
| InChIKey | XRMIKZAGKPOZHO-UHFFFAOYSA-N |
| XLogP | -2.36 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.24 |
| LogP ≤ 5 | -2.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze methyl 4-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-oxopyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-oxopyrazine-2-carboxylate?
The IUPAC name of methyl 4-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-oxopyrazine-2-carboxylate (CID 22662777) is methyl 4-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-oxopyrazine-2-carboxylate.
What is the SMILES notation for methyl 4-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-oxopyrazine-2-carboxylate?
The canonical SMILES for methyl 4-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-oxopyrazine-2-carboxylate is COC(=O)c1nccn(C2OC(CO)C(O)C2O)c1=O.
What is the InChIKey of methyl 4-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-oxopyrazine-2-carboxylate?
The InChIKey is XRMIKZAGKPOZHO-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N2O7/c1-19-11(18)6-9(17)13(3-2-12-6)10-8(16)7(15)5(4-14)20-10/h2-3,5,7-8,10,14-16H,4H2,1H3.
What are the key properties of methyl 4-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-oxopyrazine-2-carboxylate?
methyl 4-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-oxopyrazine-2-carboxylate has a molecular weight of 286.24 g/mol, XLogP of -2.36, 3 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-oxopyrazine-2-carboxylate is sourced from PubChem (CID 22662777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).