About methyl 6-chloro-4-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-oxopyrazine-2-carboxylate
methyl 6-chloro-4-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-oxopyrazine-2-carboxylate (PubChem CID 22662798) has the molecular formula C11H13ClN2O7
and a molecular weight of 320.69 g/mol. Its IUPAC name is methyl 6-chloro-4-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-oxopyrazine-2-carboxylate.
Molecular Properties
| Compound Name | methyl 6-chloro-4-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-oxopyrazine-2-carboxylate |
| PubChem CID | 22662798 |
| Molecular Formula | C11H13ClN2O7 |
| Molecular Weight | 320.69 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | methyl 6-chloro-4-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-oxopyrazine-2-carboxylate |
| SMILES | COC(=O)c1nc(Cl)cn(C2OC(CO)C(O)C2O)c1=O |
| InChI | InChI=1S/C11H13ClN2O7/c1-20-11(19)6-9(18)14(2-5(12)13-6)10-8(17)7(16)4(3-15)21-10/h2,4,7-8,10,15-17H,3H2,1H3 |
| InChIKey | MGWOMMACQWBWRU-UHFFFAOYSA-N |
| XLogP | -1.71 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.69 |
| LogP ≤ 5 | -1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Analyze methyl 6-chloro-4-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-oxopyrazine-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-chloro-4-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-oxopyrazine-2-carboxylate?
The IUPAC name of methyl 6-chloro-4-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-oxopyrazine-2-carboxylate (CID 22662798) is methyl 6-chloro-4-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-oxopyrazine-2-carboxylate.
What is the SMILES notation for methyl 6-chloro-4-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-oxopyrazine-2-carboxylate?
The canonical SMILES for methyl 6-chloro-4-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-oxopyrazine-2-carboxylate is COC(=O)c1nc(Cl)cn(C2OC(CO)C(O)C2O)c1=O.
What is the InChIKey of methyl 6-chloro-4-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-oxopyrazine-2-carboxylate?
The InChIKey is MGWOMMACQWBWRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13ClN2O7/c1-20-11(19)6-9(18)14(2-5(12)13-6)10-8(17)7(16)4(3-15)21-10/h2,4,7-8,10,15-17H,3H2,1H3.
What are the key properties of methyl 6-chloro-4-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-oxopyrazine-2-carboxylate?
methyl 6-chloro-4-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-oxopyrazine-2-carboxylate has a molecular weight of 320.69 g/mol, XLogP of -1.71, 3 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-chloro-4-[3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-3-oxopyrazine-2-carboxylate is sourced from PubChem (CID 22662798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).