C15H7Cl2IN2O4 — CID 2266296
(5E)-1-(2,3-dichlorophenyl)-5-[(5-iodofuran-2-yl)methylidene]-1,3-diazinane-2,4,6-trione (PubChem CID 2266296) has the molecular formula C15H7Cl2IN2O4 and a molecular weight of 477.04 g/mol. Its IUPAC name is (5E)-1-(2,3-dichlorophenyl)-5-[(5-iodofuran-2-yl)methylidene]-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-1-(2,3-dichlorophenyl)-5-[(5-iodofuran-2-yl)methylidene]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 2266296 |
| Molecular Formula | C15H7Cl2IN2O4 |
| Molecular Weight | 477.04 g/mol |
| Exact Mass | 475.88 |
| IUPAC Name | (5E)-1-(2,3-dichlorophenyl)-5-[(5-iodofuran-2-yl)methylidene]-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(c2cccc(Cl)c2Cl)C(=O)/C1=C/c1ccc(I)o1 |
| InChI | InChI=1S/C15H7Cl2IN2O4/c16-9-2-1-3-10(12(9)17)20-14(22)8(13(21)19-15(20)23)6-7-4-5-11(18)24-7/h1-6H,(H,19,21,23)/b8-6+ |
| InChIKey | KFQVORZUUVNZMP-SOFGYWHQSA-N |
| XLogP | 3.86 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.04 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|