About 8-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methyloctanoic acid
8-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methyloctanoic acid (PubChem CID 22662960) has the molecular formula C18H27NO2
and a molecular weight of 289.42 g/mol. Its IUPAC name is 8-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methyloctanoic acid.
Molecular Properties
| Compound Name | 8-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methyloctanoic acid |
| PubChem CID | 22662960 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 8-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methyloctanoic acid |
| SMILES | CC(CCCCCCN1CCc2ccccc2C1)C(=O)O |
| InChI | InChI=1S/C18H27NO2/c1-15(18(20)21)8-4-2-3-7-12-19-13-11-16-9-5-6-10-17(16)14-19/h5-6,9-10,15H,2-4,7-8,11-14H2,1H3,(H,20,21) |
| InChIKey | KWUBHSFORSYWFC-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methyloctanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methyloctanoic acid?
The IUPAC name of 8-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methyloctanoic acid (CID 22662960) is 8-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methyloctanoic acid.
What is the SMILES notation for 8-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methyloctanoic acid?
The canonical SMILES for 8-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methyloctanoic acid is CC(CCCCCCN1CCc2ccccc2C1)C(=O)O.
What is the InChIKey of 8-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methyloctanoic acid?
The InChIKey is KWUBHSFORSYWFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27NO2/c1-15(18(20)21)8-4-2-3-7-12-19-13-11-16-9-5-6-10-17(16)14-19/h5-6,9-10,15H,2-4,7-8,11-14H2,1H3,(H,20,21).
What are the key properties of 8-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methyloctanoic acid?
8-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methyloctanoic acid has a molecular weight of 289.42 g/mol, XLogP of 3.72, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-(3,4-dihydro-1H-isoquinolin-2-yl)-2-methyloctanoic acid is sourced from PubChem (CID 22662960), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).