About 2-(1H-pyrrolo[3,2-c]pyridin-3-yl)ethanamine
2-(1H-pyrrolo[3,2-c]pyridin-3-yl)ethanamine (PubChem CID 22662986) has the molecular formula C9H11N3
and a molecular weight of 161.21 g/mol. Its IUPAC name is 2-(1H-pyrrolo[3,2-c]pyridin-3-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(1H-pyrrolo[3,2-c]pyridin-3-yl)ethanamine |
| PubChem CID | 22662986 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 2-(1H-pyrrolo[3,2-c]pyridin-3-yl)ethanamine |
| SMILES | NCCc1c[nH]c2ccncc12 |
| InChI | InChI=1S/C9H11N3/c10-3-1-7-5-12-9-2-4-11-6-8(7)9/h2,4-6,12H,1,3,10H2 |
| InChIKey | MPGWXKYGIDJLQT-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1H-pyrrolo[3,2-c]pyridin-3-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-pyrrolo[3,2-c]pyridin-3-yl)ethanamine?
The IUPAC name of 2-(1H-pyrrolo[3,2-c]pyridin-3-yl)ethanamine (CID 22662986) is 2-(1H-pyrrolo[3,2-c]pyridin-3-yl)ethanamine.
What is the SMILES notation for 2-(1H-pyrrolo[3,2-c]pyridin-3-yl)ethanamine?
The canonical SMILES for 2-(1H-pyrrolo[3,2-c]pyridin-3-yl)ethanamine is NCCc1c[nH]c2ccncc12.
What is the InChIKey of 2-(1H-pyrrolo[3,2-c]pyridin-3-yl)ethanamine?
The InChIKey is MPGWXKYGIDJLQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3/c10-3-1-7-5-12-9-2-4-11-6-8(7)9/h2,4-6,12H,1,3,10H2.
What are the key properties of 2-(1H-pyrrolo[3,2-c]pyridin-3-yl)ethanamine?
2-(1H-pyrrolo[3,2-c]pyridin-3-yl)ethanamine has a molecular weight of 161.21 g/mol, XLogP of 1.06, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-pyrrolo[3,2-c]pyridin-3-yl)ethanamine is sourced from PubChem (CID 22662986), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).