About N-(3,5-dichloro-4-pyridinyl)-3-methyl-1H-indole-6-carboxamide
N-(3,5-dichloro-4-pyridinyl)-3-methyl-1H-indole-6-carboxamide (PubChem CID 22663193) has the molecular formula C15H11Cl2N3O
and a molecular weight of 320.18 g/mol. Its IUPAC name is N-(3,5-dichloro-4-pyridinyl)-3-methyl-1H-indole-6-carboxamide.
Molecular Properties
| Compound Name | N-(3,5-dichloro-4-pyridinyl)-3-methyl-1H-indole-6-carboxamide |
| PubChem CID | 22663193 |
| Molecular Formula | C15H11Cl2N3O |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | N-(3,5-dichloro-4-pyridinyl)-3-methyl-1H-indole-6-carboxamide |
| SMILES | Cc1c[nH]c2cc(C(=O)Nc3c(Cl)cncc3Cl)ccc12 |
| InChI | InChI=1S/C15H11Cl2N3O/c1-8-5-19-13-4-9(2-3-10(8)13)15(21)20-14-11(16)6-18-7-12(14)17/h2-7,19H,1H3,(H,18,20,21) |
| InChIKey | ONVLPDRKPJLPDE-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(3,5-dichloro-4-pyridinyl)-3-methyl-1H-indole-6-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3,5-dichloro-4-pyridinyl)-3-methyl-1H-indole-6-carboxamide?
The IUPAC name of N-(3,5-dichloro-4-pyridinyl)-3-methyl-1H-indole-6-carboxamide (CID 22663193) is N-(3,5-dichloro-4-pyridinyl)-3-methyl-1H-indole-6-carboxamide.
What is the SMILES notation for N-(3,5-dichloro-4-pyridinyl)-3-methyl-1H-indole-6-carboxamide?
The canonical SMILES for N-(3,5-dichloro-4-pyridinyl)-3-methyl-1H-indole-6-carboxamide is Cc1c[nH]c2cc(C(=O)Nc3c(Cl)cncc3Cl)ccc12.
What is the InChIKey of N-(3,5-dichloro-4-pyridinyl)-3-methyl-1H-indole-6-carboxamide?
The InChIKey is ONVLPDRKPJLPDE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11Cl2N3O/c1-8-5-19-13-4-9(2-3-10(8)13)15(21)20-14-11(16)6-18-7-12(14)17/h2-7,19H,1H3,(H,18,20,21).
What are the key properties of N-(3,5-dichloro-4-pyridinyl)-3-methyl-1H-indole-6-carboxamide?
N-(3,5-dichloro-4-pyridinyl)-3-methyl-1H-indole-6-carboxamide has a molecular weight of 320.18 g/mol, XLogP of 4.43, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3,5-dichloro-4-pyridinyl)-3-methyl-1H-indole-6-carboxamide is sourced from PubChem (CID 22663193), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).