C27H26F3N2O4S+ — CID 22663539
[1-[4-(2-phenylmethoxyphenoxy)phenyl]-1-(2,2,2-trifluoroethylsulfonyl)-2H-pyridin-1-ium-5-yl]methanamine (PubChem CID 22663539) has the molecular formula C27H26F3N2O4S+ and a molecular weight of 531.58 g/mol. Its IUPAC name is [1-[4-(2-phenylmethoxyphenoxy)phenyl]-1-(2,2,2-trifluoroethylsulfonyl)-2H-pyridin-1-ium-5-yl]methanamine.
| Compound Name | [1-[4-(2-phenylmethoxyphenoxy)phenyl]-1-(2,2,2-trifluoroethylsulfonyl)-2H-pyridin-1-ium-5-yl]methanamine |
|---|---|
| PubChem CID | 22663539 |
| Molecular Formula | C27H26F3N2O4S+ |
| Molecular Weight | 531.58 g/mol |
| Exact Mass | 531.16 |
| IUPAC Name | [1-[4-(2-phenylmethoxyphenoxy)phenyl]-1-(2,2,2-trifluoroethylsulfonyl)-2H-pyridin-1-ium-5-yl]methanamine |
| SMILES | NCC1=C[N+](c2ccc(Oc3ccccc3OCc3ccccc3)cc2)(S(=O)(=O)CC(F)(F)F)CC=C1 |
| InChI | InChI=1S/C27H26F3N2O4S/c28-27(29,30)20-37(33,34)32(16-6-9-22(17-31)18-32)23-12-14-24(15-13-23)36-26-11-5-4-10-25(26)35-19-21-7-2-1-3-8-21/h1-15,18H,16-17,19-20,31H2/q+1 |
| InChIKey | PQPRCGUTVBIIMM-UHFFFAOYSA-N |
| XLogP | 5.67 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.58 |
| LogP ≤ 5 | 5.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|