C21H19F3N3O3S+ — CID 22663585
4-[4-[5-(aminomethyl)-1-(2,2,2-trifluoroethylsulfonyl)-2H-pyridin-1-ium-1-yl]phenoxy]benzonitrile (PubChem CID 22663585) has the molecular formula C21H19F3N3O3S+ and a molecular weight of 450.46 g/mol. Its IUPAC name is 4-[4-[5-(aminomethyl)-1-(2,2,2-trifluoroethylsulfonyl)-2H-pyridin-1-ium-1-yl]phenoxy]benzonitrile.
| Compound Name | 4-[4-[5-(aminomethyl)-1-(2,2,2-trifluoroethylsulfonyl)-2H-pyridin-1-ium-1-yl]phenoxy]benzonitrile |
|---|---|
| PubChem CID | 22663585 |
| Molecular Formula | C21H19F3N3O3S+ |
| Molecular Weight | 450.46 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | 4-[4-[5-(aminomethyl)-1-(2,2,2-trifluoroethylsulfonyl)-2H-pyridin-1-ium-1-yl]phenoxy]benzonitrile |
| SMILES | N#Cc1ccc(Oc2ccc([N+]3(S(=O)(=O)CC(F)(F)F)C=C(CN)C=CC3)cc2)cc1 |
| InChI | InChI=1S/C21H19F3N3O3S/c22-21(23,24)15-31(28,29)27(11-1-2-17(13-26)14-27)18-5-9-20(10-6-18)30-19-7-3-16(12-25)4-8-19/h1-10,14H,11,13,15,26H2/q+1 |
| InChIKey | YBZRGRYUPPRHRF-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 93.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.46 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|