C22H24F3N2O4S+ — CID 22663588
[1-[4-(2-ethoxyphenoxy)phenyl]-1-(2,2,2-trifluoroethylsulfonyl)-2H-pyridin-1-ium-5-yl]methanamine (PubChem CID 22663588) has the molecular formula C22H24F3N2O4S+ and a molecular weight of 469.51 g/mol. Its IUPAC name is [1-[4-(2-ethoxyphenoxy)phenyl]-1-(2,2,2-trifluoroethylsulfonyl)-2H-pyridin-1-ium-5-yl]methanamine.
| Compound Name | [1-[4-(2-ethoxyphenoxy)phenyl]-1-(2,2,2-trifluoroethylsulfonyl)-2H-pyridin-1-ium-5-yl]methanamine |
|---|---|
| PubChem CID | 22663588 |
| Molecular Formula | C22H24F3N2O4S+ |
| Molecular Weight | 469.51 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | [1-[4-(2-ethoxyphenoxy)phenyl]-1-(2,2,2-trifluoroethylsulfonyl)-2H-pyridin-1-ium-5-yl]methanamine |
| SMILES | CCOc1ccccc1Oc1ccc([N+]2(S(=O)(=O)CC(F)(F)F)C=C(CN)C=CC2)cc1 |
| InChI | InChI=1S/C22H24F3N2O4S/c1-2-30-20-7-3-4-8-21(20)31-19-11-9-18(10-12-19)27(13-5-6-17(14-26)15-27)32(28,29)16-22(23,24)25/h3-12,15H,2,13-14,16,26H2,1H3/q+1 |
| InChIKey | KCQMUVWXGCZZSJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.51 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|