C21H22F3N2O4S+ — CID 22663636
[1-[4-(2-methoxyphenoxy)phenyl]-1-(2,2,2-trifluoroethylsulfonyl)-2H-pyridin-1-ium-5-yl]methanamine (PubChem CID 22663636) has the molecular formula C21H22F3N2O4S+ and a molecular weight of 455.48 g/mol. Its IUPAC name is [1-[4-(2-methoxyphenoxy)phenyl]-1-(2,2,2-trifluoroethylsulfonyl)-2H-pyridin-1-ium-5-yl]methanamine.
| Compound Name | [1-[4-(2-methoxyphenoxy)phenyl]-1-(2,2,2-trifluoroethylsulfonyl)-2H-pyridin-1-ium-5-yl]methanamine |
|---|---|
| PubChem CID | 22663636 |
| Molecular Formula | C21H22F3N2O4S+ |
| Molecular Weight | 455.48 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | [1-[4-(2-methoxyphenoxy)phenyl]-1-(2,2,2-trifluoroethylsulfonyl)-2H-pyridin-1-ium-5-yl]methanamine |
| SMILES | COc1ccccc1Oc1ccc([N+]2(S(=O)(=O)CC(F)(F)F)C=C(CN)C=CC2)cc1 |
| InChI | InChI=1S/C21H22F3N2O4S/c1-29-19-6-2-3-7-20(19)30-18-10-8-17(9-11-18)26(12-4-5-16(13-25)14-26)31(27,28)15-21(22,23)24/h2-11,14H,12-13,15,25H2,1H3/q+1 |
| InChIKey | SVUCXLLSLDVBCB-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|