C20H19ClF3N2O3S+ — CID 22663920
[1-[4-(4-chlorophenoxy)phenyl]-1-(2,2,2-trifluoroethylsulfonyl)-2H-pyridin-1-ium-5-yl]methanamine (PubChem CID 22663920) has the molecular formula C20H19ClF3N2O3S+ and a molecular weight of 459.90 g/mol. Its IUPAC name is [1-[4-(4-chlorophenoxy)phenyl]-1-(2,2,2-trifluoroethylsulfonyl)-2H-pyridin-1-ium-5-yl]methanamine.
| Compound Name | [1-[4-(4-chlorophenoxy)phenyl]-1-(2,2,2-trifluoroethylsulfonyl)-2H-pyridin-1-ium-5-yl]methanamine |
|---|---|
| PubChem CID | 22663920 |
| Molecular Formula | C20H19ClF3N2O3S+ |
| Molecular Weight | 459.90 g/mol |
| Exact Mass | 459.08 |
| IUPAC Name | [1-[4-(4-chlorophenoxy)phenyl]-1-(2,2,2-trifluoroethylsulfonyl)-2H-pyridin-1-ium-5-yl]methanamine |
| SMILES | NCC1=C[N+](c2ccc(Oc3ccc(Cl)cc3)cc2)(S(=O)(=O)CC(F)(F)F)CC=C1 |
| InChI | InChI=1S/C20H19ClF3N2O3S/c21-16-3-7-18(8-4-16)29-19-9-5-17(6-10-19)26(11-1-2-15(12-25)13-26)30(27,28)14-20(22,23)24/h1-10,13H,11-12,14,25H2/q+1 |
| InChIKey | DJEBYGUNOAQGFT-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.90 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|