About 2-[amino-bis(1,4-benzodioxin-3-yl)methyl]phenol
2-[amino-bis(1,4-benzodioxin-3-yl)methyl]phenol (PubChem CID 22664077) has the molecular formula C23H17NO5
and a molecular weight of 387.39 g/mol. Its IUPAC name is 2-[amino-bis(1,4-benzodioxin-3-yl)methyl]phenol.
Molecular Properties
| Compound Name | 2-[amino-bis(1,4-benzodioxin-3-yl)methyl]phenol |
| PubChem CID | 22664077 |
| Molecular Formula | C23H17NO5 |
| Molecular Weight | 387.39 g/mol |
| Exact Mass | 387.11 |
| IUPAC Name | 2-[amino-bis(1,4-benzodioxin-3-yl)methyl]phenol |
| SMILES | NC(C1=COc2ccccc2O1)(C1=COc2ccccc2O1)c1ccccc1O |
| InChI | InChI=1S/C23H17NO5/c24-23(15-7-1-2-8-16(15)25,21-13-26-17-9-3-5-11-19(17)28-21)22-14-27-18-10-4-6-12-20(18)29-22/h1-14,25H,24H2 |
| InChIKey | SVOCBNUACRJALB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 83.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.39 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 2-[amino-bis(1,4-benzodioxin-3-yl)methyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[amino-bis(1,4-benzodioxin-3-yl)methyl]phenol?
The IUPAC name of 2-[amino-bis(1,4-benzodioxin-3-yl)methyl]phenol (CID 22664077) is 2-[amino-bis(1,4-benzodioxin-3-yl)methyl]phenol.
What is the SMILES notation for 2-[amino-bis(1,4-benzodioxin-3-yl)methyl]phenol?
The canonical SMILES for 2-[amino-bis(1,4-benzodioxin-3-yl)methyl]phenol is NC(C1=COc2ccccc2O1)(C1=COc2ccccc2O1)c1ccccc1O.
What is the InChIKey of 2-[amino-bis(1,4-benzodioxin-3-yl)methyl]phenol?
The InChIKey is SVOCBNUACRJALB-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17NO5/c24-23(15-7-1-2-8-16(15)25,21-13-26-17-9-3-5-11-19(17)28-21)22-14-27-18-10-4-6-12-20(18)29-22/h1-14,25H,24H2.
What are the key properties of 2-[amino-bis(1,4-benzodioxin-3-yl)methyl]phenol?
2-[amino-bis(1,4-benzodioxin-3-yl)methyl]phenol has a molecular weight of 387.39 g/mol, XLogP of 4.17, 3 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[amino-bis(1,4-benzodioxin-3-yl)methyl]phenol is sourced from PubChem (CID 22664077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).