About 8-aminodibenzofuran-2-ol
8-aminodibenzofuran-2-ol (PubChem CID 22664086) has the molecular formula C12H9NO2
and a molecular weight of 199.21 g/mol. Its IUPAC name is 8-aminodibenzofuran-2-ol.
Molecular Properties
| Compound Name | 8-aminodibenzofuran-2-ol |
| PubChem CID | 22664086 |
| Molecular Formula | C12H9NO2 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | 8-aminodibenzofuran-2-ol |
| SMILES | Nc1ccc2oc3ccc(O)cc3c2c1 |
| InChI | InChI=1S/C12H9NO2/c13-7-1-3-11-9(5-7)10-6-8(14)2-4-12(10)15-11/h1-6,14H,13H2 |
| InChIKey | APSUJGACQVCEFB-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 8-aminodibenzofuran-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-aminodibenzofuran-2-ol?
The IUPAC name of 8-aminodibenzofuran-2-ol (CID 22664086) is 8-aminodibenzofuran-2-ol.
What is the SMILES notation for 8-aminodibenzofuran-2-ol?
The canonical SMILES for 8-aminodibenzofuran-2-ol is Nc1ccc2oc3ccc(O)cc3c2c1.
What is the InChIKey of 8-aminodibenzofuran-2-ol?
The InChIKey is APSUJGACQVCEFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO2/c13-7-1-3-11-9(5-7)10-6-8(14)2-4-12(10)15-11/h1-6,14H,13H2.
What are the key properties of 8-aminodibenzofuran-2-ol?
8-aminodibenzofuran-2-ol has a molecular weight of 199.21 g/mol, XLogP of 2.87, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 8-aminodibenzofuran-2-ol is sourced from PubChem (CID 22664086), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).