C17H17Cl2F3N4O2 — CID 2266482
(5S,7R)-5-(3,4-dichlorophenyl)-N-(2-methoxyethyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide (PubChem CID 2266482) has the molecular formula C17H17Cl2F3N4O2 and a molecular weight of 437.25 g/mol. Its IUPAC name is (5S,7R)-5-(3,4-dichlorophenyl)-N-(2-methoxyethyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide.
| Compound Name | (5S,7R)-5-(3,4-dichlorophenyl)-N-(2-methoxyethyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|---|
| PubChem CID | 2266482 |
| Molecular Formula | C17H17Cl2F3N4O2 |
| Molecular Weight | 437.25 g/mol |
| Exact Mass | 436.07 |
| IUPAC Name | (5S,7R)-5-(3,4-dichlorophenyl)-N-(2-methoxyethyl)-7-(trifluoromethyl)-4,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
| SMILES | COCCNC(=O)c1cc2n(n1)[C@@H](C(F)(F)F)C[C@@H](c1ccc(Cl)c(Cl)c1)N2 |
| InChI | InChI=1S/C17H17Cl2F3N4O2/c1-28-5-4-23-16(27)13-8-15-24-12(9-2-3-10(18)11(19)6-9)7-14(17(20,21)22)26(15)25-13/h2-3,6,8,12,14,24H,4-5,7H2,1H3,(H,23,27)/t12-,14+/m0/s1 |
| InChIKey | PDUAIQSYECUBEX-GXTWGEPZSA-N |
| XLogP | 4.23 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.25 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|