About 1,3-oxazolidin-2-one azide
1,3-oxazolidin-2-one azide (PubChem CID 22664916) has the molecular formula C3H5N4O2-
and a molecular weight of 129.10 g/mol. Its IUPAC name is 1,3-oxazolidin-2-one azide.
Molecular Properties
| Compound Name | 1,3-oxazolidin-2-one azide |
| PubChem CID | 22664916 |
| Molecular Formula | C3H5N4O2- |
| Molecular Weight | 129.10 g/mol |
| Exact Mass | 129.04 |
| IUPAC Name | 1,3-oxazolidin-2-one azide |
| SMILES | O=C1NCCO1.[N-]=[N+]=[N-] |
| InChI | InChI=1S/C3H5NO2.N3/c5-3-4-1-2-6-3;1-3-2/h1-2H2,(H,4,5);/q;-1 |
| InChIKey | ZQHJODCOEDDZDS-UHFFFAOYSA-N |
| XLogP | 0.59 |
| TPSA | 97.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.10 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 1,3-oxazolidin-2-one azide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-oxazolidin-2-one azide?
The IUPAC name of 1,3-oxazolidin-2-one azide (CID 22664916) is 1,3-oxazolidin-2-one azide.
What is the SMILES notation for 1,3-oxazolidin-2-one azide?
The canonical SMILES for 1,3-oxazolidin-2-one azide is O=C1NCCO1.[N-]=[N+]=[N-].
What is the InChIKey of 1,3-oxazolidin-2-one azide?
The InChIKey is ZQHJODCOEDDZDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5NO2.N3/c5-3-4-1-2-6-3;1-3-2/h1-2H2,(H,4,5);/q;-1.
What are the key properties of 1,3-oxazolidin-2-one azide?
1,3-oxazolidin-2-one azide has a molecular weight of 129.10 g/mol, XLogP of 0.59, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-oxazolidin-2-one azide is sourced from PubChem (CID 22664916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).