C15H13N — CID 22665415
tricyclo[9.4.0.02,4]pentadeca-1(15),2(4),5,7,9,11,13-heptaen-3-amine (PubChem CID 22665415) has the molecular formula C15H13N and a molecular weight of 207.28 g/mol. Its IUPAC name is tricyclo[9.4.0.02,4]pentadeca-1(15),2(4),5,7,9,11,13-heptaen-3-amine.
| Compound Name | tricyclo[9.4.0.02,4]pentadeca-1(15),2(4),5,7,9,11,13-heptaen-3-amine |
|---|---|
| PubChem CID | 22665415 |
| Molecular Formula | C15H13N |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | tricyclo[9.4.0.02,4]pentadeca-1(15),2(4),5,7,9,11,13-heptaen-3-amine |
| SMILES | NC1c2ccccccc3ccccc3c21 |
| InChI | InChI=1S/C15H13N/c16-15-13-10-4-2-1-3-7-11-8-5-6-9-12(11)14(13)15/h1-10,15H,16H2/b2-1-,3-1+,4-2-,7-3+,10-4-,11-7-,13-10+,14-12+ |
| InChIKey | LYXDYBFEKDMBOK-BEBYVUFKSA-N |
| XLogP | 3.33 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |