C8H8N2O2 — CID 22665425
1,4,4a,5-tetrahydroquinoxaline-2,3-dione (PubChem CID 22665425) has the molecular formula C8H8N2O2 and a molecular weight of 164.16 g/mol. Its IUPAC name is 1,4,4a,5-tetrahydroquinoxaline-2,3-dione.
| Compound Name | 1,4,4a,5-tetrahydroquinoxaline-2,3-dione |
|---|---|
| PubChem CID | 22665425 |
| Molecular Formula | C8H8N2O2 |
| Molecular Weight | 164.16 g/mol |
| Exact Mass | 164.06 |
| IUPAC Name | 1,4,4a,5-tetrahydroquinoxaline-2,3-dione |
| SMILES | O=C1NC2=CC=CCC2NC1=O |
| InChI | InChI=1S/C8H8N2O2/c11-7-8(12)10-6-4-2-1-3-5(6)9-7/h1-3,6H,4H2,(H,9,11)(H,10,12) |
| InChIKey | WEWWGCMAZQRYGK-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.16 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|