C20H20N2O4 — CID 22665693
1-(2-benzamido-2-phenylacetyl)pyrrolidine-2-carboxylic acid (PubChem CID 22665693) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is 1-(2-benzamido-2-phenylacetyl)pyrrolidine-2-carboxylic acid.
| Compound Name | 1-(2-benzamido-2-phenylacetyl)pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 22665693 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 1-(2-benzamido-2-phenylacetyl)pyrrolidine-2-carboxylic acid |
| SMILES | O=C(NC(C(=O)N1CCCC1C(=O)O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H20N2O4/c23-18(15-10-5-2-6-11-15)21-17(14-8-3-1-4-9-14)19(24)22-13-7-12-16(22)20(25)26/h1-6,8-11,16-17H,7,12-13H2,(H,21,23)(H,25,26) |
| InChIKey | ZIORDQWFTVTQRS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |