About 1,3-bis(ethenyl)-1,3-dimethylurea
1,3-bis(ethenyl)-1,3-dimethylurea (PubChem CID 22666839) has the molecular formula C7H12N2O
and a molecular weight of 140.19 g/mol. Its IUPAC name is 1,3-bis(ethenyl)-1,3-dimethylurea.
Molecular Properties
| Compound Name | 1,3-bis(ethenyl)-1,3-dimethylurea |
| PubChem CID | 22666839 |
| Molecular Formula | C7H12N2O |
| Molecular Weight | 140.19 g/mol |
| Exact Mass | 140.09 |
| IUPAC Name | 1,3-bis(ethenyl)-1,3-dimethylurea |
| SMILES | C=CN(C)C(=O)N(C)C=C |
| InChI | InChI=1S/C7H12N2O/c1-5-8(3)7(10)9(4)6-2/h5-6H,1-2H2,3-4H3 |
| InChIKey | MEZHXEHEMNCXLI-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.19 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1,3-bis(ethenyl)-1,3-dimethylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-bis(ethenyl)-1,3-dimethylurea?
The IUPAC name of 1,3-bis(ethenyl)-1,3-dimethylurea (CID 22666839) is 1,3-bis(ethenyl)-1,3-dimethylurea.
What is the SMILES notation for 1,3-bis(ethenyl)-1,3-dimethylurea?
The canonical SMILES for 1,3-bis(ethenyl)-1,3-dimethylurea is C=CN(C)C(=O)N(C)C=C.
What is the InChIKey of 1,3-bis(ethenyl)-1,3-dimethylurea?
The InChIKey is MEZHXEHEMNCXLI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O/c1-5-8(3)7(10)9(4)6-2/h5-6H,1-2H2,3-4H3.
What are the key properties of 1,3-bis(ethenyl)-1,3-dimethylurea?
1,3-bis(ethenyl)-1,3-dimethylurea has a molecular weight of 140.19 g/mol, XLogP of 1.26, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-bis(ethenyl)-1,3-dimethylurea is sourced from PubChem (CID 22666839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).