About 1-butyl-3-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]urea
1-butyl-3-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]urea (PubChem CID 22667145) has the molecular formula C21H24N4O4
and a molecular weight of 396.45 g/mol. Its IUPAC name is 1-butyl-3-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]urea.
Molecular Properties
| Compound Name | 1-butyl-3-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]urea |
| PubChem CID | 22667145 |
| Molecular Formula | C21H24N4O4 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | 1-butyl-3-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]urea |
| SMILES | CCCCNC(=O)Nc1ccc(Oc2ncnc3cc(OC)c(OC)cc23)cc1 |
| InChI | InChI=1S/C21H24N4O4/c1-4-5-10-22-21(26)25-14-6-8-15(9-7-14)29-20-16-11-18(27-2)19(28-3)12-17(16)23-13-24-20/h6-9,11-13H,4-5,10H2,1-3H3,(H2,22,25,26) |
| InChIKey | IDNHCMZLIRXIKO-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 94.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1-butyl-3-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-butyl-3-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]urea?
The IUPAC name of 1-butyl-3-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]urea (CID 22667145) is 1-butyl-3-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]urea.
What is the SMILES notation for 1-butyl-3-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]urea?
The canonical SMILES for 1-butyl-3-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]urea is CCCCNC(=O)Nc1ccc(Oc2ncnc3cc(OC)c(OC)cc23)cc1.
What is the InChIKey of 1-butyl-3-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]urea?
The InChIKey is IDNHCMZLIRXIKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H24N4O4/c1-4-5-10-22-21(26)25-14-6-8-15(9-7-14)29-20-16-11-18(27-2)19(28-3)12-17(16)23-13-24-20/h6-9,11-13H,4-5,10H2,1-3H3,(H2,22,25,26).
What are the key properties of 1-butyl-3-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]urea?
1-butyl-3-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]urea has a molecular weight of 396.45 g/mol, XLogP of 4.36, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-butyl-3-[4-(6,7-dimethoxyquinazolin-4-yl)oxyphenyl]urea is sourced from PubChem (CID 22667145), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).