C17H19BrF5NO4 — CID 22668796
methyl 5-(1-bromo-2,2-dimethoxyethyl)-4-(cyclopropylmethyl)-2-(difluoromethyl)-6-(trifluoromethyl)pyridine-3-carboxylate (PubChem CID 22668796) has the molecular formula C17H19BrF5NO4 and a molecular weight of 476.24 g/mol. Its IUPAC name is methyl 5-(1-bromo-2,2-dimethoxyethyl)-4-(cyclopropylmethyl)-2-(difluoromethyl)-6-(trifluoromethyl)pyridine-3-carboxylate.
| Compound Name | methyl 5-(1-bromo-2,2-dimethoxyethyl)-4-(cyclopropylmethyl)-2-(difluoromethyl)-6-(trifluoromethyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 22668796 |
| Molecular Formula | C17H19BrF5NO4 |
| Molecular Weight | 476.24 g/mol |
| Exact Mass | 475.04 |
| IUPAC Name | methyl 5-(1-bromo-2,2-dimethoxyethyl)-4-(cyclopropylmethyl)-2-(difluoromethyl)-6-(trifluoromethyl)pyridine-3-carboxylate |
| SMILES | COC(=O)c1c(C(F)F)nc(C(F)(F)F)c(C(Br)C(OC)OC)c1CC1CC1 |
| InChI | InChI=1S/C17H19BrF5NO4/c1-26-15(25)10-8(6-7-4-5-7)9(11(18)16(27-2)28-3)13(17(21,22)23)24-12(10)14(19)20/h7,11,14,16H,4-6H2,1-3H3 |
| InChIKey | NXUGQDPIBBQYHI-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.24 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|