About 2-amino-2-[4-[[3-(4-fluorophenyl)sulfonyl-1H-indol-5-yl]oxy]-3,5-dimethylphenyl]acetic acid
2-amino-2-[4-[[3-(4-fluorophenyl)sulfonyl-1H-indol-5-yl]oxy]-3,5-dimethylphenyl]acetic acid (PubChem CID 22669384) has the molecular formula C24H21FN2O5S
and a molecular weight of 468.51 g/mol. Its IUPAC name is 2-amino-2-[4-[[3-(4-fluorophenyl)sulfonyl-1H-indol-5-yl]oxy]-3,5-dimethylphenyl]acetic acid.
Molecular Properties
| Compound Name | 2-amino-2-[4-[[3-(4-fluorophenyl)sulfonyl-1H-indol-5-yl]oxy]-3,5-dimethylphenyl]acetic acid |
| PubChem CID | 22669384 |
| Molecular Formula | C24H21FN2O5S |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.12 |
| IUPAC Name | 2-amino-2-[4-[[3-(4-fluorophenyl)sulfonyl-1H-indol-5-yl]oxy]-3,5-dimethylphenyl]acetic acid |
| SMILES | Cc1cc(C(N)C(=O)O)cc(C)c1Oc1ccc2[nH]cc(S(=O)(=O)c3ccc(F)cc3)c2c1 |
| InChI | InChI=1S/C24H21FN2O5S/c1-13-9-15(22(26)24(28)29)10-14(2)23(13)32-17-5-8-20-19(11-17)21(12-27-20)33(30,31)18-6-3-16(25)4-7-18/h3-12,22,27H,26H2,1-2H3,(H,28,29) |
| InChIKey | QNDIXPQSQSZIJL-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 122.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-amino-2-[4-[[3-(4-fluorophenyl)sulfonyl-1H-indol-5-yl]oxy]-3,5-dimethylphenyl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-[4-[[3-(4-fluorophenyl)sulfonyl-1H-indol-5-yl]oxy]-3,5-dimethylphenyl]acetic acid?
The IUPAC name of 2-amino-2-[4-[[3-(4-fluorophenyl)sulfonyl-1H-indol-5-yl]oxy]-3,5-dimethylphenyl]acetic acid (CID 22669384) is 2-amino-2-[4-[[3-(4-fluorophenyl)sulfonyl-1H-indol-5-yl]oxy]-3,5-dimethylphenyl]acetic acid.
What is the SMILES notation for 2-amino-2-[4-[[3-(4-fluorophenyl)sulfonyl-1H-indol-5-yl]oxy]-3,5-dimethylphenyl]acetic acid?
The canonical SMILES for 2-amino-2-[4-[[3-(4-fluorophenyl)sulfonyl-1H-indol-5-yl]oxy]-3,5-dimethylphenyl]acetic acid is Cc1cc(C(N)C(=O)O)cc(C)c1Oc1ccc2[nH]cc(S(=O)(=O)c3ccc(F)cc3)c2c1.
What is the InChIKey of 2-amino-2-[4-[[3-(4-fluorophenyl)sulfonyl-1H-indol-5-yl]oxy]-3,5-dimethylphenyl]acetic acid?
The InChIKey is QNDIXPQSQSZIJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H21FN2O5S/c1-13-9-15(22(26)24(28)29)10-14(2)23(13)32-17-5-8-20-19(11-17)21(12-27-20)33(30,31)18-6-3-16(25)4-7-18/h3-12,22,27H,26H2,1-2H3,(H,28,29).
What are the key properties of 2-amino-2-[4-[[3-(4-fluorophenyl)sulfonyl-1H-indol-5-yl]oxy]-3,5-dimethylphenyl]acetic acid?
2-amino-2-[4-[[3-(4-fluorophenyl)sulfonyl-1H-indol-5-yl]oxy]-3,5-dimethylphenyl]acetic acid has a molecular weight of 468.51 g/mol, XLogP of 4.63, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-[4-[[3-(4-fluorophenyl)sulfonyl-1H-indol-5-yl]oxy]-3,5-dimethylphenyl]acetic acid is sourced from PubChem (CID 22669384), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).